About 2-(4-fluoro-2,3-dihydro-1H-inden-1-yl)propan-1-amine
2-(4-fluoro-2,3-dihydro-1H-inden-1-yl)propan-1-amine (PubChem CID 83907555) has the molecular formula C12H16FN
and a molecular weight of 193.27 g/mol. Its IUPAC name is 2-(4-fluoro-2,3-dihydro-1H-inden-1-yl)propan-1-amine.
Molecular Properties
| Compound Name | 2-(4-fluoro-2,3-dihydro-1H-inden-1-yl)propan-1-amine |
| PubChem CID | 83907555 |
| Molecular Formula | C12H16FN |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 2-(4-fluoro-2,3-dihydro-1H-inden-1-yl)propan-1-amine |
| SMILES | CC(CN)C1CCc2c(F)cccc21 |
| InChI | InChI=1S/C12H16FN/c1-8(7-14)9-5-6-11-10(9)3-2-4-12(11)13/h2-4,8-9H,5-7,14H2,1H3 |
| InChIKey | MPCRGPCRDZCDCE-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(4-fluoro-2,3-dihydro-1H-inden-1-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluoro-2,3-dihydro-1H-inden-1-yl)propan-1-amine?
The IUPAC name of 2-(4-fluoro-2,3-dihydro-1H-inden-1-yl)propan-1-amine (CID 83907555) is 2-(4-fluoro-2,3-dihydro-1H-inden-1-yl)propan-1-amine.
What is the SMILES notation for 2-(4-fluoro-2,3-dihydro-1H-inden-1-yl)propan-1-amine?
The canonical SMILES for 2-(4-fluoro-2,3-dihydro-1H-inden-1-yl)propan-1-amine is CC(CN)C1CCc2c(F)cccc21.
What is the InChIKey of 2-(4-fluoro-2,3-dihydro-1H-inden-1-yl)propan-1-amine?
The InChIKey is MPCRGPCRDZCDCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16FN/c1-8(7-14)9-5-6-11-10(9)3-2-4-12(11)13/h2-4,8-9H,5-7,14H2,1H3.
What are the key properties of 2-(4-fluoro-2,3-dihydro-1H-inden-1-yl)propan-1-amine?
2-(4-fluoro-2,3-dihydro-1H-inden-1-yl)propan-1-amine has a molecular weight of 193.27 g/mol, XLogP of 2.45, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluoro-2,3-dihydro-1H-inden-1-yl)propan-1-amine is sourced from PubChem (CID 83907555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).