C11H13FS — CID 130671865
1-ethylsulfanyl-4-fluoro-2,3-dihydro-1H-indene (PubChem CID 130671865) has the molecular formula C11H13FS and a molecular weight of 196.29 g/mol. Its IUPAC name is 1-ethylsulfanyl-4-fluoro-2,3-dihydro-1H-indene.
| Compound Name | 1-ethylsulfanyl-4-fluoro-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 130671865 |
| Molecular Formula | C11H13FS |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 1-ethylsulfanyl-4-fluoro-2,3-dihydro-1H-indene |
| SMILES | CCSC1CCc2c(F)cccc21 |
| InChI | InChI=1S/C11H13FS/c1-2-13-11-7-6-8-9(11)4-3-5-10(8)12/h3-5,11H,2,6-7H2,1H3 |
| InChIKey | ZISJDUYNPYHNLW-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |