C15H20FNO2S — CID 97014216
N-(2-ethoxyethyl)-2-[[(1S)-4-fluoro-2,3-dihydro-1H-inden-1-yl]sulfanyl]acetamide (PubChem CID 97014216) has the molecular formula C15H20FNO2S and a molecular weight of 297.40 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-2-[[(1S)-4-fluoro-2,3-dihydro-1H-inden-1-yl]sulfanyl]acetamide.
| Compound Name | N-(2-ethoxyethyl)-2-[[(1S)-4-fluoro-2,3-dihydro-1H-inden-1-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 97014216 |
| Molecular Formula | C15H20FNO2S |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | N-(2-ethoxyethyl)-2-[[(1S)-4-fluoro-2,3-dihydro-1H-inden-1-yl]sulfanyl]acetamide |
| SMILES | CCOCCNC(=O)CS[C@H]1CCc2c(F)cccc21 |
| InChI | InChI=1S/C15H20FNO2S/c1-2-19-9-8-17-15(18)10-20-14-7-6-11-12(14)4-3-5-13(11)16/h3-5,14H,2,6-10H2,1H3,(H,17,18)/t14-/m0/s1 |
| InChIKey | FESYSJDQGLQTDD-AWEZNQCLSA-N |
| XLogP | 2.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|