C10H14ClN — CID 134159261
(1R)-4-methyl-2,3-dihydro-1H-inden-1-amine;hydrochloride (PubChem CID 134159261) has the molecular formula C10H14ClN and a molecular weight of 183.68 g/mol. Its IUPAC name is (1R)-4-methyl-2,3-dihydro-1H-inden-1-amine;hydrochloride.
| Compound Name | (1R)-4-methyl-2,3-dihydro-1H-inden-1-amine;hydrochloride |
|---|---|
| PubChem CID | 134159261 |
| Molecular Formula | C10H14ClN |
| Molecular Weight | 183.68 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | (1R)-4-methyl-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| SMILES | Cc1cccc2c1CC[C@H]2N.Cl |
| InChI | InChI=1S/C10H13N.ClH/c1-7-3-2-4-9-8(7)5-6-10(9)11;/h2-4,10H,5-6,11H2,1H3;1H/t10-;/m1./s1 |
| InChIKey | NDMCZAVGDDQQOO-HNCPQSOCSA-N |
| XLogP | 2.36 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.68 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |