C10H12ClNO — CID 55272709
4-chloro-5-methoxy-2,3-dihydro-1H-inden-1-amine (PubChem CID 55272709) has the molecular formula C10H12ClNO and a molecular weight of 197.66 g/mol. Its IUPAC name is 4-chloro-5-methoxy-2,3-dihydro-1H-inden-1-amine.
| Compound Name | 4-chloro-5-methoxy-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 55272709 |
| Molecular Formula | C10H12ClNO |
| Molecular Weight | 197.66 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 4-chloro-5-methoxy-2,3-dihydro-1H-inden-1-amine |
| SMILES | COc1ccc2c(c1Cl)CCC2N |
| InChI | InChI=1S/C10H12ClNO/c1-13-9-5-3-6-7(10(9)11)2-4-8(6)12/h3,5,8H,2,4,12H2,1H3 |
| InChIKey | GHGXOTINTLOATN-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.66 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |