C10H10ClNO2 — CID 130839484
(1R)-1-amino-4-chloro-2,3-dihydro-1H-indene-5-carboxylic acid (PubChem CID 130839484) has the molecular formula C10H10ClNO2 and a molecular weight of 211.65 g/mol. Its IUPAC name is (1R)-1-amino-4-chloro-2,3-dihydro-1H-indene-5-carboxylic acid.
| Compound Name | (1R)-1-amino-4-chloro-2,3-dihydro-1H-indene-5-carboxylic acid |
|---|---|
| PubChem CID | 130839484 |
| Molecular Formula | C10H10ClNO2 |
| Molecular Weight | 211.65 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | (1R)-1-amino-4-chloro-2,3-dihydro-1H-indene-5-carboxylic acid |
| SMILES | N[C@@H]1CCc2c1ccc(C(=O)O)c2Cl |
| InChI | InChI=1S/C10H10ClNO2/c11-9-6-3-4-8(12)5(6)1-2-7(9)10(13)14/h1-2,8H,3-4,12H2,(H,13,14)/t8-/m1/s1 |
| InChIKey | FPWLVMLZXMDHLP-MRVPVSSYSA-N |
| XLogP | 1.98 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.65 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |