About 5-O-methyl 4-O-propan-2-yl 1-amino-2,3-dihydro-1H-indene-4,5-dicarboxylate
5-O-methyl 4-O-propan-2-yl 1-amino-2,3-dihydro-1H-indene-4,5-dicarboxylate (PubChem CID 150000037) has the molecular formula C15H19NO4
and a molecular weight of 277.32 g/mol. Its IUPAC name is 5-O-methyl 4-O-propan-2-yl 1-amino-2,3-dihydro-1H-indene-4,5-dicarboxylate.
Molecular Properties
| Compound Name | 5-O-methyl 4-O-propan-2-yl 1-amino-2,3-dihydro-1H-indene-4,5-dicarboxylate |
| PubChem CID | 150000037 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 5-O-methyl 4-O-propan-2-yl 1-amino-2,3-dihydro-1H-indene-4,5-dicarboxylate |
| SMILES | COC(=O)c1ccc2c(c1C(=O)OC(C)C)CCC2N |
| InChI | InChI=1S/C15H19NO4/c1-8(2)20-15(18)13-10-6-7-12(16)9(10)4-5-11(13)14(17)19-3/h4-5,8,12H,6-7,16H2,1-3H3 |
| InChIKey | DBBWUFPATCEDCA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-O-methyl 4-O-propan-2-yl 1-amino-2,3-dihydro-1H-indene-4,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-O-methyl 4-O-propan-2-yl 1-amino-2,3-dihydro-1H-indene-4,5-dicarboxylate?
The IUPAC name of 5-O-methyl 4-O-propan-2-yl 1-amino-2,3-dihydro-1H-indene-4,5-dicarboxylate (CID 150000037) is 5-O-methyl 4-O-propan-2-yl 1-amino-2,3-dihydro-1H-indene-4,5-dicarboxylate.
What is the SMILES notation for 5-O-methyl 4-O-propan-2-yl 1-amino-2,3-dihydro-1H-indene-4,5-dicarboxylate?
The canonical SMILES for 5-O-methyl 4-O-propan-2-yl 1-amino-2,3-dihydro-1H-indene-4,5-dicarboxylate is COC(=O)c1ccc2c(c1C(=O)OC(C)C)CCC2N.
What is the InChIKey of 5-O-methyl 4-O-propan-2-yl 1-amino-2,3-dihydro-1H-indene-4,5-dicarboxylate?
The InChIKey is DBBWUFPATCEDCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO4/c1-8(2)20-15(18)13-10-6-7-12(16)9(10)4-5-11(13)14(17)19-3/h4-5,8,12H,6-7,16H2,1-3H3.
What are the key properties of 5-O-methyl 4-O-propan-2-yl 1-amino-2,3-dihydro-1H-indene-4,5-dicarboxylate?
5-O-methyl 4-O-propan-2-yl 1-amino-2,3-dihydro-1H-indene-4,5-dicarboxylate has a molecular weight of 277.32 g/mol, XLogP of 1.98, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-O-methyl 4-O-propan-2-yl 1-amino-2,3-dihydro-1H-indene-4,5-dicarboxylate is sourced from PubChem (CID 150000037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).