C9H9ClIN — CID 130632392
(1S)-5-chloro-4-iodo-2,3-dihydro-1H-inden-1-amine (PubChem CID 130632392) has the molecular formula C9H9ClIN and a molecular weight of 293.54 g/mol. Its IUPAC name is (1S)-5-chloro-4-iodo-2,3-dihydro-1H-inden-1-amine.
| Compound Name | (1S)-5-chloro-4-iodo-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 130632392 |
| Molecular Formula | C9H9ClIN |
| Molecular Weight | 293.54 g/mol |
| Exact Mass | 292.95 |
| IUPAC Name | (1S)-5-chloro-4-iodo-2,3-dihydro-1H-inden-1-amine |
| SMILES | N[C@H]1CCc2c1ccc(Cl)c2I |
| InChI | InChI=1S/C9H9ClIN/c10-7-3-1-5-6(9(7)11)2-4-8(5)12/h1,3,8H,2,4,12H2/t8-/m0/s1 |
| InChIKey | XNSKFOFNLNKNAW-QMMMGPOBSA-N |
| XLogP | 2.89 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.54 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|