C12H15BrO5 — CID 86225062
2-[2-bromo-3-methoxy-4-(methoxymethoxy)phenyl]-1,3-dioxolane (PubChem CID 86225062) has the molecular formula C12H15BrO5 and a molecular weight of 319.15 g/mol. Its IUPAC name is 2-[2-bromo-3-methoxy-4-(methoxymethoxy)phenyl]-1,3-dioxolane.
| Compound Name | 2-[2-bromo-3-methoxy-4-(methoxymethoxy)phenyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 86225062 |
| Molecular Formula | C12H15BrO5 |
| Molecular Weight | 319.15 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | 2-[2-bromo-3-methoxy-4-(methoxymethoxy)phenyl]-1,3-dioxolane |
| SMILES | COCOc1ccc(C2OCCO2)c(Br)c1OC |
| InChI | InChI=1S/C12H15BrO5/c1-14-7-18-9-4-3-8(10(13)11(9)15-2)12-16-5-6-17-12/h3-4,12H,5-7H2,1-2H3 |
| InChIKey | VSAKJIXVUUTRGY-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.15 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|