C18H19NO5 — CID 19701573
[3-(1,3-dioxolan-2-yl)-2-pyridinyl]-[2-(methoxymethoxy)-5-methylphenyl]methanone (PubChem CID 19701573) has the molecular formula C18H19NO5 and a molecular weight of 329.35 g/mol. Its IUPAC name is [3-(1,3-dioxolan-2-yl)-2-pyridinyl]-[2-(methoxymethoxy)-5-methylphenyl]methanone.
| Compound Name | [3-(1,3-dioxolan-2-yl)-2-pyridinyl]-[2-(methoxymethoxy)-5-methylphenyl]methanone |
|---|---|
| PubChem CID | 19701573 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | [3-(1,3-dioxolan-2-yl)-2-pyridinyl]-[2-(methoxymethoxy)-5-methylphenyl]methanone |
| SMILES | COCOc1ccc(C)cc1C(=O)c1ncccc1C1OCCO1 |
| InChI | InChI=1S/C18H19NO5/c1-12-5-6-15(24-11-21-2)14(10-12)17(20)16-13(4-3-7-19-16)18-22-8-9-23-18/h3-7,10,18H,8-9,11H2,1-2H3 |
| InChIKey | WEZGUZNHGYKBHY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|