C11H13BrO3 — CID 66692910
2-(2-bromo-3-ethoxyphenyl)-1,3-dioxolane (PubChem CID 66692910) has the molecular formula C11H13BrO3 and a molecular weight of 273.13 g/mol. Its IUPAC name is 2-(2-bromo-3-ethoxyphenyl)-1,3-dioxolane.
| Compound Name | 2-(2-bromo-3-ethoxyphenyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 66692910 |
| Molecular Formula | C11H13BrO3 |
| Molecular Weight | 273.13 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | 2-(2-bromo-3-ethoxyphenyl)-1,3-dioxolane |
| SMILES | CCOc1cccc(C2OCCO2)c1Br |
| InChI | InChI=1S/C11H13BrO3/c1-2-13-9-5-3-4-8(10(9)12)11-14-6-7-15-11/h3-5,11H,2,6-7H2,1H3 |
| InChIKey | QGYPFOMOQCWEDT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.13 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |