C11H14O4 — CID 170873933
2-[2-(1,3-dioxolan-2-yl)phenoxy]ethanol (PubChem CID 170873933) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is 2-[2-(1,3-dioxolan-2-yl)phenoxy]ethanol.
| Compound Name | 2-[2-(1,3-dioxolan-2-yl)phenoxy]ethanol |
|---|---|
| PubChem CID | 170873933 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 2-[2-(1,3-dioxolan-2-yl)phenoxy]ethanol |
| SMILES | OCCOc1ccccc1C1OCCO1 |
| InChI | InChI=1S/C11H14O4/c12-5-6-13-10-4-2-1-3-9(10)11-14-7-8-15-11/h1-4,11-12H,5-8H2 |
| InChIKey | IOMCOFCVWUOZLT-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |