C12H17NO2 — CID 142440877
N,N-dimethyl-2-[2-(oxiran-2-yl)phenoxy]ethanamine (PubChem CID 142440877) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is N,N-dimethyl-2-[2-(oxiran-2-yl)phenoxy]ethanamine.
| Compound Name | N,N-dimethyl-2-[2-(oxiran-2-yl)phenoxy]ethanamine |
|---|---|
| PubChem CID | 142440877 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | N,N-dimethyl-2-[2-(oxiran-2-yl)phenoxy]ethanamine |
| SMILES | CN(C)CCOc1ccccc1C1CO1 |
| InChI | InChI=1S/C12H17NO2/c1-13(2)7-8-14-11-6-4-3-5-10(11)12-9-15-12/h3-6,12H,7-9H2,1-2H3 |
| InChIKey | YAGRRGVGQQUOKZ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 25.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|