About 5-[2-(1,3-dioxan-2-yl)phenoxy]-2-methylpent-3-yn-2-ol;ethane
5-[2-(1,3-dioxan-2-yl)phenoxy]-2-methylpent-3-yn-2-ol;ethane (PubChem CID 142462787) has the molecular formula C18H26O4
and a molecular weight of 306.40 g/mol. Its IUPAC name is 5-[2-(1,3-dioxan-2-yl)phenoxy]-2-methylpent-3-yn-2-ol;ethane.
Molecular Properties
| Compound Name | 5-[2-(1,3-dioxan-2-yl)phenoxy]-2-methylpent-3-yn-2-ol;ethane |
| PubChem CID | 142462787 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 5-[2-(1,3-dioxan-2-yl)phenoxy]-2-methylpent-3-yn-2-ol;ethane |
| SMILES | CC.CC(C)(O)C#CCOc1ccccc1C1OCCCO1 |
| InChI | InChI=1S/C16H20O4.C2H6/c1-16(2,17)9-5-10-18-14-8-4-3-7-13(14)15-19-11-6-12-20-15;1-2/h3-4,7-8,15,17H,6,10-12H2,1-2H3;1-2H3 |
| InChIKey | DYHPAYBLYUVEBI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-(1,3-dioxan-2-yl)phenoxy]-2-methylpent-3-yn-2-ol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(1,3-dioxan-2-yl)phenoxy]-2-methylpent-3-yn-2-ol;ethane?
The IUPAC name of 5-[2-(1,3-dioxan-2-yl)phenoxy]-2-methylpent-3-yn-2-ol;ethane (CID 142462787) is 5-[2-(1,3-dioxan-2-yl)phenoxy]-2-methylpent-3-yn-2-ol;ethane.
What is the SMILES notation for 5-[2-(1,3-dioxan-2-yl)phenoxy]-2-methylpent-3-yn-2-ol;ethane?
The canonical SMILES for 5-[2-(1,3-dioxan-2-yl)phenoxy]-2-methylpent-3-yn-2-ol;ethane is CC.CC(C)(O)C#CCOc1ccccc1C1OCCCO1.
What is the InChIKey of 5-[2-(1,3-dioxan-2-yl)phenoxy]-2-methylpent-3-yn-2-ol;ethane?
The InChIKey is DYHPAYBLYUVEBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20O4.C2H6/c1-16(2,17)9-5-10-18-14-8-4-3-7-13(14)15-19-11-6-12-20-15;1-2/h3-4,7-8,15,17H,6,10-12H2,1-2H3;1-2H3.
What are the key properties of 5-[2-(1,3-dioxan-2-yl)phenoxy]-2-methylpent-3-yn-2-ol;ethane?
5-[2-(1,3-dioxan-2-yl)phenoxy]-2-methylpent-3-yn-2-ol;ethane has a molecular weight of 306.40 g/mol, XLogP of 3.30, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(1,3-dioxan-2-yl)phenoxy]-2-methylpent-3-yn-2-ol;ethane is sourced from PubChem (CID 142462787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).