C18H26O4 — CID 142462787
5-[2-(1,3-dioxan-2-yl)phenoxy]-2-methylpent-3-yn-2-ol;ethane (PubChem CID 142462787) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is 5-[2-(1,3-dioxan-2-yl)phenoxy]-2-methylpent-3-yn-2-ol;ethane.
| Compound Name | 5-[2-(1,3-dioxan-2-yl)phenoxy]-2-methylpent-3-yn-2-ol;ethane |
|---|---|
| PubChem CID | 142462787 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 5-[2-(1,3-dioxan-2-yl)phenoxy]-2-methylpent-3-yn-2-ol;ethane |
| SMILES | CC.CC(C)(O)C#CCOc1ccccc1C1OCCCO1 |
| InChI | InChI=1S/C16H20O4.C2H6/c1-16(2,17)9-5-10-18-14-8-4-3-7-13(14)15-19-11-6-12-20-15;1-2/h3-4,7-8,15,17H,6,10-12H2,1-2H3;1-2H3 |
| InChIKey | DYHPAYBLYUVEBI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|