C18H22O3 — CID 155929658
6-[2-(1,3-dioxan-2-yl)phenyl]-2,2-dimethylhex-5-ynal (PubChem CID 155929658) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is 6-[2-(1,3-dioxan-2-yl)phenyl]-2,2-dimethylhex-5-ynal.
| Compound Name | 6-[2-(1,3-dioxan-2-yl)phenyl]-2,2-dimethylhex-5-ynal |
|---|---|
| PubChem CID | 155929658 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | 6-[2-(1,3-dioxan-2-yl)phenyl]-2,2-dimethylhex-5-ynal |
| SMILES | CC(C)(C=O)CCC#Cc1ccccc1C1OCCCO1 |
| InChI | InChI=1S/C18H22O3/c1-18(2,14-19)11-6-5-9-15-8-3-4-10-16(15)17-20-12-7-13-21-17/h3-4,8,10,14,17H,6-7,11-13H2,1-2H3 |
| InChIKey | RNDUZXXHPHKYIT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|