C13H11NO2 — CID 170475516
4-[2-(1,3-dioxolan-2-yl)phenyl]but-3-ynenitrile (PubChem CID 170475516) has the molecular formula C13H11NO2 and a molecular weight of 213.24 g/mol. Its IUPAC name is 4-[2-(1,3-dioxolan-2-yl)phenyl]but-3-ynenitrile.
| Compound Name | 4-[2-(1,3-dioxolan-2-yl)phenyl]but-3-ynenitrile |
|---|---|
| PubChem CID | 170475516 |
| Molecular Formula | C13H11NO2 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 4-[2-(1,3-dioxolan-2-yl)phenyl]but-3-ynenitrile |
| SMILES | N#CCC#Cc1ccccc1C1OCCO1 |
| InChI | InChI=1S/C13H11NO2/c14-8-4-3-6-11-5-1-2-7-12(11)13-15-9-10-16-13/h1-2,5,7,13H,4,9-10H2 |
| InChIKey | GVNRQWIHZXQXIM-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|