About 2-[2-[2-(1,3-dioxolan-2-yl)phenyl]tellanylphenyl]-1,3-dioxolane
2-[2-[2-(1,3-dioxolan-2-yl)phenyl]tellanylphenyl]-1,3-dioxolane (PubChem CID 3059910) has the molecular formula C18H18O4Te
and a molecular weight of 425.94 g/mol. Its IUPAC name is 2-[2-[2-(1,3-dioxolan-2-yl)phenyl]tellanylphenyl]-1,3-dioxolane.
Molecular Properties
| Compound Name | 2-[2-[2-(1,3-dioxolan-2-yl)phenyl]tellanylphenyl]-1,3-dioxolane |
| PubChem CID | 3059910 |
| Molecular Formula | C18H18O4Te |
| Molecular Weight | 425.94 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | 2-[2-[2-(1,3-dioxolan-2-yl)phenyl]tellanylphenyl]-1,3-dioxolane |
| SMILES | c1ccc(C2OCCO2)c([Te]c2ccccc2C2OCCO2)c1 |
| InChI | InChI=1S/C18H18O4Te/c1-3-7-15(13(5-1)17-19-9-10-20-17)23-16-8-4-2-6-14(16)18-21-11-12-22-18/h1-8,17-18H,9-12H2 |
| InChIKey | ZVBQTEROIILNJN-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.94 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[2-(1,3-dioxolan-2-yl)phenyl]tellanylphenyl]-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[2-(1,3-dioxolan-2-yl)phenyl]tellanylphenyl]-1,3-dioxolane?
The IUPAC name of 2-[2-[2-(1,3-dioxolan-2-yl)phenyl]tellanylphenyl]-1,3-dioxolane (CID 3059910) is 2-[2-[2-(1,3-dioxolan-2-yl)phenyl]tellanylphenyl]-1,3-dioxolane.
What is the SMILES notation for 2-[2-[2-(1,3-dioxolan-2-yl)phenyl]tellanylphenyl]-1,3-dioxolane?
The canonical SMILES for 2-[2-[2-(1,3-dioxolan-2-yl)phenyl]tellanylphenyl]-1,3-dioxolane is c1ccc(C2OCCO2)c([Te]c2ccccc2C2OCCO2)c1.
What is the InChIKey of 2-[2-[2-(1,3-dioxolan-2-yl)phenyl]tellanylphenyl]-1,3-dioxolane?
The InChIKey is ZVBQTEROIILNJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O4Te/c1-3-7-15(13(5-1)17-19-9-10-20-17)23-16-8-4-2-6-14(16)18-21-11-12-22-18/h1-8,17-18H,9-12H2.
What are the key properties of 2-[2-[2-(1,3-dioxolan-2-yl)phenyl]tellanylphenyl]-1,3-dioxolane?
2-[2-[2-(1,3-dioxolan-2-yl)phenyl]tellanylphenyl]-1,3-dioxolane has a molecular weight of 425.94 g/mol, XLogP of 1.43, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-(1,3-dioxolan-2-yl)phenyl]tellanylphenyl]-1,3-dioxolane is sourced from PubChem (CID 3059910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).