C18H18O4Te — CID 3059910
2-[2-[2-(1,3-dioxolan-2-yl)phenyl]tellanylphenyl]-1,3-dioxolane (PubChem CID 3059910) has the molecular formula C18H18O4Te and a molecular weight of 425.94 g/mol. Its IUPAC name is 2-[2-[2-(1,3-dioxolan-2-yl)phenyl]tellanylphenyl]-1,3-dioxolane.
| Compound Name | 2-[2-[2-(1,3-dioxolan-2-yl)phenyl]tellanylphenyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 3059910 |
| Molecular Formula | C18H18O4Te |
| Molecular Weight | 425.94 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | 2-[2-[2-(1,3-dioxolan-2-yl)phenyl]tellanylphenyl]-1,3-dioxolane |
| SMILES | c1ccc(C2OCCO2)c([Te]c2ccccc2C2OCCO2)c1 |
| InChI | InChI=1S/C18H18O4Te/c1-3-7-15(13(5-1)17-19-9-10-20-17)23-16-8-4-2-6-14(16)18-21-11-12-22-18/h1-8,17-18H,9-12H2 |
| InChIKey | ZVBQTEROIILNJN-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.94 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|