C17H25O2P — CID 91988659
2-[2-(2,5-diethylphospholan-1-yl)phenyl]-1,3-dioxolane (PubChem CID 91988659) has the molecular formula C17H25O2P and a molecular weight of 292.36 g/mol. Its IUPAC name is 2-[2-(2,5-diethylphospholan-1-yl)phenyl]-1,3-dioxolane.
| Compound Name | 2-[2-(2,5-diethylphospholan-1-yl)phenyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 91988659 |
| Molecular Formula | C17H25O2P |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 2-[2-(2,5-diethylphospholan-1-yl)phenyl]-1,3-dioxolane |
| SMILES | CCC1CCC(CC)P1c1ccccc1C1OCCO1 |
| InChI | InChI=1S/C17H25O2P/c1-3-13-9-10-14(4-2)20(13)16-8-6-5-7-15(16)17-18-11-12-19-17/h5-8,13-14,17H,3-4,9-12H2,1-2H3 |
| InChIKey | UKBFKBMQNUOKTD-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|