About [2-(1,3-dioxan-2-yl)phenyl]-methyl-diphenylphosphanium
[2-(1,3-dioxan-2-yl)phenyl]-methyl-diphenylphosphanium (PubChem CID 88507724) has the molecular formula C23H24O2P+
and a molecular weight of 363.42 g/mol. Its IUPAC name is [2-(1,3-dioxan-2-yl)phenyl]-methyl-diphenylphosphanium.
Molecular Properties
| Compound Name | [2-(1,3-dioxan-2-yl)phenyl]-methyl-diphenylphosphanium |
| PubChem CID | 88507724 |
| Molecular Formula | C23H24O2P+ |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | [2-(1,3-dioxan-2-yl)phenyl]-methyl-diphenylphosphanium |
| SMILES | C[P+](c1ccccc1)(c1ccccc1)c1ccccc1C1OCCCO1 |
| InChI | InChI=1S/C23H24O2P/c1-26(19-11-4-2-5-12-19,20-13-6-3-7-14-20)22-16-9-8-15-21(22)23-24-17-10-18-25-23/h2-9,11-16,23H,10,17-18H2,1H3/q+1 |
| InChIKey | WKVQBMUTOUYEJP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2-(1,3-dioxan-2-yl)phenyl]-methyl-diphenylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,3-dioxan-2-yl)phenyl]-methyl-diphenylphosphanium?
The IUPAC name of [2-(1,3-dioxan-2-yl)phenyl]-methyl-diphenylphosphanium (CID 88507724) is [2-(1,3-dioxan-2-yl)phenyl]-methyl-diphenylphosphanium.
What is the SMILES notation for [2-(1,3-dioxan-2-yl)phenyl]-methyl-diphenylphosphanium?
The canonical SMILES for [2-(1,3-dioxan-2-yl)phenyl]-methyl-diphenylphosphanium is C[P+](c1ccccc1)(c1ccccc1)c1ccccc1C1OCCCO1.
What is the InChIKey of [2-(1,3-dioxan-2-yl)phenyl]-methyl-diphenylphosphanium?
The InChIKey is WKVQBMUTOUYEJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24O2P/c1-26(19-11-4-2-5-12-19,20-13-6-3-7-14-20)22-16-9-8-15-21(22)23-24-17-10-18-25-23/h2-9,11-16,23H,10,17-18H2,1H3/q+1.
What are the key properties of [2-(1,3-dioxan-2-yl)phenyl]-methyl-diphenylphosphanium?
[2-(1,3-dioxan-2-yl)phenyl]-methyl-diphenylphosphanium has a molecular weight of 363.42 g/mol, XLogP of 4.05, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,3-dioxan-2-yl)phenyl]-methyl-diphenylphosphanium is sourced from PubChem (CID 88507724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).