About [2-(1,3-dioxolan-2-yl)phenyl] N-(2,4-dimethyl-3-oxopentan-2-yl)sulfanyl-N-methylcarbamate
[2-(1,3-dioxolan-2-yl)phenyl] N-(2,4-dimethyl-3-oxopentan-2-yl)sulfanyl-N-methylcarbamate (PubChem CID 54136669) has the molecular formula C18H25NO5S
and a molecular weight of 367.47 g/mol. Its IUPAC name is [2-(1,3-dioxolan-2-yl)phenyl] N-(2,4-dimethyl-3-oxopentan-2-yl)sulfanyl-N-methylcarbamate.
Molecular Properties
| Compound Name | [2-(1,3-dioxolan-2-yl)phenyl] N-(2,4-dimethyl-3-oxopentan-2-yl)sulfanyl-N-methylcarbamate |
| PubChem CID | 54136669 |
| Molecular Formula | C18H25NO5S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | [2-(1,3-dioxolan-2-yl)phenyl] N-(2,4-dimethyl-3-oxopentan-2-yl)sulfanyl-N-methylcarbamate |
| SMILES | CC(C)C(=O)C(C)(C)SN(C)C(=O)Oc1ccccc1C1OCCO1 |
| InChI | InChI=1S/C18H25NO5S/c1-12(2)15(20)18(3,4)25-19(5)17(21)24-14-9-7-6-8-13(14)16-22-10-11-23-16/h6-9,12,16H,10-11H2,1-5H3 |
| InChIKey | NYEXINTZTRSXCP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-(1,3-dioxolan-2-yl)phenyl] N-(2,4-dimethyl-3-oxopentan-2-yl)sulfanyl-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,3-dioxolan-2-yl)phenyl] N-(2,4-dimethyl-3-oxopentan-2-yl)sulfanyl-N-methylcarbamate?
The IUPAC name of [2-(1,3-dioxolan-2-yl)phenyl] N-(2,4-dimethyl-3-oxopentan-2-yl)sulfanyl-N-methylcarbamate (CID 54136669) is [2-(1,3-dioxolan-2-yl)phenyl] N-(2,4-dimethyl-3-oxopentan-2-yl)sulfanyl-N-methylcarbamate.
What is the SMILES notation for [2-(1,3-dioxolan-2-yl)phenyl] N-(2,4-dimethyl-3-oxopentan-2-yl)sulfanyl-N-methylcarbamate?
The canonical SMILES for [2-(1,3-dioxolan-2-yl)phenyl] N-(2,4-dimethyl-3-oxopentan-2-yl)sulfanyl-N-methylcarbamate is CC(C)C(=O)C(C)(C)SN(C)C(=O)Oc1ccccc1C1OCCO1.
What is the InChIKey of [2-(1,3-dioxolan-2-yl)phenyl] N-(2,4-dimethyl-3-oxopentan-2-yl)sulfanyl-N-methylcarbamate?
The InChIKey is NYEXINTZTRSXCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25NO5S/c1-12(2)15(20)18(3,4)25-19(5)17(21)24-14-9-7-6-8-13(14)16-22-10-11-23-16/h6-9,12,16H,10-11H2,1-5H3.
What are the key properties of [2-(1,3-dioxolan-2-yl)phenyl] N-(2,4-dimethyl-3-oxopentan-2-yl)sulfanyl-N-methylcarbamate?
[2-(1,3-dioxolan-2-yl)phenyl] N-(2,4-dimethyl-3-oxopentan-2-yl)sulfanyl-N-methylcarbamate has a molecular weight of 367.47 g/mol, XLogP of 3.81, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,3-dioxolan-2-yl)phenyl] N-(2,4-dimethyl-3-oxopentan-2-yl)sulfanyl-N-methylcarbamate is sourced from PubChem (CID 54136669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).