C12H13BrO4 — CID 155128506
2-[2-bromo-3-[[(2R)-oxiran-2-yl]methoxy]phenyl]-1,3-dioxolane (PubChem CID 155128506) has the molecular formula C12H13BrO4 and a molecular weight of 301.14 g/mol. Its IUPAC name is 2-[2-bromo-3-[[(2R)-oxiran-2-yl]methoxy]phenyl]-1,3-dioxolane.
| Compound Name | 2-[2-bromo-3-[[(2R)-oxiran-2-yl]methoxy]phenyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 155128506 |
| Molecular Formula | C12H13BrO4 |
| Molecular Weight | 301.14 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | 2-[2-bromo-3-[[(2R)-oxiran-2-yl]methoxy]phenyl]-1,3-dioxolane |
| SMILES | Brc1c(OC[C@H]2CO2)cccc1C1OCCO1 |
| InChI | InChI=1S/C12H13BrO4/c13-11-9(12-14-4-5-15-12)2-1-3-10(11)17-7-8-6-16-8/h1-3,8,12H,4-7H2/t8-/m1/s1 |
| InChIKey | JLDIKJVIKBGUSA-MRVPVSSYSA-N |
| XLogP | 2.27 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.14 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|