C14H18O2 — CID 58590244
2-[(1,2-dimethyl-2,3-dihydro-1H-inden-4-yl)oxymethyl]oxirane (PubChem CID 58590244) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-[(1,2-dimethyl-2,3-dihydro-1H-inden-4-yl)oxymethyl]oxirane.
| Compound Name | 2-[(1,2-dimethyl-2,3-dihydro-1H-inden-4-yl)oxymethyl]oxirane |
|---|---|
| PubChem CID | 58590244 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 2-[(1,2-dimethyl-2,3-dihydro-1H-inden-4-yl)oxymethyl]oxirane |
| SMILES | CC1Cc2c(OCC3CO3)cccc2C1C |
| InChI | InChI=1S/C14H18O2/c1-9-6-13-12(10(9)2)4-3-5-14(13)16-8-11-7-15-11/h3-5,9-11H,6-8H2,1-2H3 |
| InChIKey | GZEDUUIPAKUAJP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|