C15H18O4 — CID 86748747
oxirane;5-[[(2S)-oxiran-2-yl]methoxy]-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 86748747) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is oxirane;5-[[(2S)-oxiran-2-yl]methoxy]-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | oxirane;5-[[(2S)-oxiran-2-yl]methoxy]-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 86748747 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | oxirane;5-[[(2S)-oxiran-2-yl]methoxy]-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | C1CO1.O=C1CCCc2c(OC[C@@H]3CO3)cccc21 |
| InChI | InChI=1S/C13H14O3.C2H4O/c14-12-5-1-4-11-10(12)3-2-6-13(11)16-8-9-7-15-9;1-2-3-1/h2-3,6,9H,1,4-5,7-8H2;1-2H2/t9-;/m0./s1 |
| InChIKey | VUUYIVOVDSICEH-FVGYRXGTSA-N |
| XLogP | 2.00 |
| TPSA | 51.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|