C11H13BrO3 — CID 14378759
2-(5-bromo-2-methoxyphenyl)-1,3-dioxane (PubChem CID 14378759) has the molecular formula C11H13BrO3 and a molecular weight of 273.13 g/mol. Its IUPAC name is 2-(5-bromo-2-methoxyphenyl)-1,3-dioxane.
| Compound Name | 2-(5-bromo-2-methoxyphenyl)-1,3-dioxane |
|---|---|
| PubChem CID | 14378759 |
| Molecular Formula | C11H13BrO3 |
| Molecular Weight | 273.13 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | 2-(5-bromo-2-methoxyphenyl)-1,3-dioxane |
| SMILES | COc1ccc(Br)cc1C1OCCCO1 |
| InChI | InChI=1S/C11H13BrO3/c1-13-10-4-3-8(12)7-9(10)11-14-5-2-6-15-11/h3-4,7,11H,2,5-6H2,1H3 |
| InChIKey | QYGXFNAOPHJOMY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.13 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |