C11H11F3O3 — CID 130785461
2-[4-methoxy-2-(trifluoromethyl)phenyl]-1,3-dioxolane (PubChem CID 130785461) has the molecular formula C11H11F3O3 and a molecular weight of 248.20 g/mol. Its IUPAC name is 2-[4-methoxy-2-(trifluoromethyl)phenyl]-1,3-dioxolane.
| Compound Name | 2-[4-methoxy-2-(trifluoromethyl)phenyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 130785461 |
| Molecular Formula | C11H11F3O3 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 2-[4-methoxy-2-(trifluoromethyl)phenyl]-1,3-dioxolane |
| SMILES | COc1ccc(C2OCCO2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H11F3O3/c1-15-7-2-3-8(10-16-4-5-17-10)9(6-7)11(12,13)14/h2-3,6,10H,4-5H2,1H3 |
| InChIKey | JVDLWLXZUZWRTP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |