C10H8BrF3O3 — CID 130760257
4-bromo-2-(1,3-dioxolan-2-yl)-6-(trifluoromethyl)phenol (PubChem CID 130760257) has the molecular formula C10H8BrF3O3 and a molecular weight of 313.07 g/mol. Its IUPAC name is 4-bromo-2-(1,3-dioxolan-2-yl)-6-(trifluoromethyl)phenol.
| Compound Name | 4-bromo-2-(1,3-dioxolan-2-yl)-6-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 130760257 |
| Molecular Formula | C10H8BrF3O3 |
| Molecular Weight | 313.07 g/mol |
| Exact Mass | 311.96 |
| IUPAC Name | 4-bromo-2-(1,3-dioxolan-2-yl)-6-(trifluoromethyl)phenol |
| SMILES | Oc1c(C2OCCO2)cc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C10H8BrF3O3/c11-5-3-6(9-16-1-2-17-9)8(15)7(4-5)10(12,13)14/h3-4,9,15H,1-2H2 |
| InChIKey | DTHJMQOBGUECJG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.07 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |