C9H10BrClF3NO — CID 171255621
2-[(1S)-1-aminoethyl]-4-bromo-6-(trifluoromethyl)phenol;hydrochloride (PubChem CID 171255621) has the molecular formula C9H10BrClF3NO and a molecular weight of 320.54 g/mol. Its IUPAC name is 2-[(1S)-1-aminoethyl]-4-bromo-6-(trifluoromethyl)phenol;hydrochloride.
| Compound Name | 2-[(1S)-1-aminoethyl]-4-bromo-6-(trifluoromethyl)phenol;hydrochloride |
|---|---|
| PubChem CID | 171255621 |
| Molecular Formula | C9H10BrClF3NO |
| Molecular Weight | 320.54 g/mol |
| Exact Mass | 318.96 |
| IUPAC Name | 2-[(1S)-1-aminoethyl]-4-bromo-6-(trifluoromethyl)phenol;hydrochloride |
| SMILES | C[C@H](N)c1cc(Br)cc(C(F)(F)F)c1O.Cl |
| InChI | InChI=1S/C9H9BrF3NO.ClH/c1-4(14)6-2-5(10)3-7(8(6)15)9(11,12)13;/h2-4,15H,14H2,1H3;1H/t4-;/m0./s1 |
| InChIKey | YIHICVXZNOLXGU-WCCKRBBISA-N |
| XLogP | 3.62 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.54 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|