C14H8Br2F6O2 — CID 160517438
2,4-dibromo-6-(trifluoromethyl)phenol;2-(trifluoromethyl)phenol (PubChem CID 160517438) has the molecular formula C14H8Br2F6O2 and a molecular weight of 482.01 g/mol. Its IUPAC name is 2,4-dibromo-6-(trifluoromethyl)phenol;2-(trifluoromethyl)phenol.
| Compound Name | 2,4-dibromo-6-(trifluoromethyl)phenol;2-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 160517438 |
| Molecular Formula | C14H8Br2F6O2 |
| Molecular Weight | 482.01 g/mol |
| Exact Mass | 479.88 |
| IUPAC Name | 2,4-dibromo-6-(trifluoromethyl)phenol;2-(trifluoromethyl)phenol |
| SMILES | Oc1c(Br)cc(Br)cc1C(F)(F)F.Oc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C7H3Br2F3O.C7H5F3O/c8-3-1-4(7(10,11)12)6(13)5(9)2-3;8-7(9,10)5-3-1-2-4-6(5)11/h1-2,13H;1-4,11H |
| InChIKey | QTVJQGGUHICABW-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.01 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |