About 1-bromo-2-(trifluoromethyl)benzene;phenol
1-bromo-2-(trifluoromethyl)benzene;phenol (PubChem CID 174917942) has the molecular formula C13H10BrF3O
and a molecular weight of 319.12 g/mol. Its IUPAC name is 1-bromo-2-(trifluoromethyl)benzene;phenol.
Molecular Properties
| Compound Name | 1-bromo-2-(trifluoromethyl)benzene;phenol |
| PubChem CID | 174917942 |
| Molecular Formula | C13H10BrF3O |
| Molecular Weight | 319.12 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | 1-bromo-2-(trifluoromethyl)benzene;phenol |
| SMILES | FC(F)(F)c1ccccc1Br.Oc1ccccc1 |
| InChI | InChI=1S/C7H4BrF3.C6H6O/c8-6-4-2-1-3-5(6)7(9,10)11;7-6-4-2-1-3-5-6/h1-4H;1-5,7H |
| InChIKey | SIRSUDMJHMISJH-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.12 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-bromo-2-(trifluoromethyl)benzene;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-(trifluoromethyl)benzene;phenol?
The IUPAC name of 1-bromo-2-(trifluoromethyl)benzene;phenol (CID 174917942) is 1-bromo-2-(trifluoromethyl)benzene;phenol.
What is the SMILES notation for 1-bromo-2-(trifluoromethyl)benzene;phenol?
The canonical SMILES for 1-bromo-2-(trifluoromethyl)benzene;phenol is FC(F)(F)c1ccccc1Br.Oc1ccccc1.
What is the InChIKey of 1-bromo-2-(trifluoromethyl)benzene;phenol?
The InChIKey is SIRSUDMJHMISJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BrF3.C6H6O/c8-6-4-2-1-3-5(6)7(9,10)11;7-6-4-2-1-3-5-6/h1-4H;1-5,7H.
What are the key properties of 1-bromo-2-(trifluoromethyl)benzene;phenol?
1-bromo-2-(trifluoromethyl)benzene;phenol has a molecular weight of 319.12 g/mol, XLogP of 4.86, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-(trifluoromethyl)benzene;phenol is sourced from PubChem (CID 174917942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).