C17H26O3 — CID 170873937
2,4-ditert-butyl-6-(1,3-dioxolan-2-yl)phenol (PubChem CID 170873937) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-(1,3-dioxolan-2-yl)phenol.
| Compound Name | 2,4-ditert-butyl-6-(1,3-dioxolan-2-yl)phenol |
|---|---|
| PubChem CID | 170873937 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 2,4-ditert-butyl-6-(1,3-dioxolan-2-yl)phenol |
| SMILES | CC(C)(C)c1cc(C2OCCO2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C17H26O3/c1-16(2,3)11-9-12(15-19-7-8-20-15)14(18)13(10-11)17(4,5)6/h9-10,15,18H,7-8H2,1-6H3 |
| InChIKey | IIXQOFGHSHECHG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |