C15H22O3 — CID 83959269
2-(3-tert-butyl-2-methoxy-5-methylphenyl)-1,3-dioxolane (PubChem CID 83959269) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-(3-tert-butyl-2-methoxy-5-methylphenyl)-1,3-dioxolane.
| Compound Name | 2-(3-tert-butyl-2-methoxy-5-methylphenyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 83959269 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 2-(3-tert-butyl-2-methoxy-5-methylphenyl)-1,3-dioxolane |
| SMILES | COc1c(C2OCCO2)cc(C)cc1C(C)(C)C |
| InChI | InChI=1S/C15H22O3/c1-10-8-11(14-17-6-7-18-14)13(16-5)12(9-10)15(2,3)4/h8-9,14H,6-7H2,1-5H3 |
| InChIKey | YSEAMJOZGNXIEB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |