C19H28OSi — CID 87556435
(3-tert-butyl-2-methoxy-5-methylphenyl)-cyclopenta-2,4-dien-1-yl-dimethylsilane (PubChem CID 87556435) has the molecular formula C19H28OSi and a molecular weight of 300.52 g/mol. Its IUPAC name is (3-tert-butyl-2-methoxy-5-methylphenyl)-cyclopenta-2,4-dien-1-yl-dimethylsilane.
| Compound Name | (3-tert-butyl-2-methoxy-5-methylphenyl)-cyclopenta-2,4-dien-1-yl-dimethylsilane |
|---|---|
| PubChem CID | 87556435 |
| Molecular Formula | C19H28OSi |
| Molecular Weight | 300.52 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | (3-tert-butyl-2-methoxy-5-methylphenyl)-cyclopenta-2,4-dien-1-yl-dimethylsilane |
| SMILES | COc1c(C(C)(C)C)cc(C)cc1[Si](C)(C)C1C=CC=C1 |
| InChI | InChI=1S/C19H28OSi/c1-14-12-16(19(2,3)4)18(20-5)17(13-14)21(6,7)15-10-8-9-11-15/h8-13,15H,1-7H3 |
| InChIKey | UAAKDAJOVXBEDB-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.52 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|