C21H32OSi — CID 87556760
(3-tert-butyl-2-methoxy-5-methylphenyl)-cyclopenta-2,4-dien-1-yl-diethylsilane (PubChem CID 87556760) has the molecular formula C21H32OSi and a molecular weight of 328.57 g/mol. Its IUPAC name is (3-tert-butyl-2-methoxy-5-methylphenyl)-cyclopenta-2,4-dien-1-yl-diethylsilane.
| Compound Name | (3-tert-butyl-2-methoxy-5-methylphenyl)-cyclopenta-2,4-dien-1-yl-diethylsilane |
|---|---|
| PubChem CID | 87556760 |
| Molecular Formula | C21H32OSi |
| Molecular Weight | 328.57 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | (3-tert-butyl-2-methoxy-5-methylphenyl)-cyclopenta-2,4-dien-1-yl-diethylsilane |
| SMILES | CC[Si](CC)(c1cc(C)cc(C(C)(C)C)c1OC)C1C=CC=C1 |
| InChI | InChI=1S/C21H32OSi/c1-8-23(9-2,17-12-10-11-13-17)19-15-16(3)14-18(20(19)22-7)21(4,5)6/h10-15,17H,8-9H2,1-7H3 |
| InChIKey | LFHMTIMYLJGSON-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.57 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|