C23H38OSi — CID 150340216
(3-tert-butyl-2-methoxy-5-methylphenyl)-dimethyl-(2,3,3,4-tetramethylcyclopenten-1-yl)silane (PubChem CID 150340216) has the molecular formula C23H38OSi and a molecular weight of 358.64 g/mol. Its IUPAC name is (3-tert-butyl-2-methoxy-5-methylphenyl)-dimethyl-(2,3,3,4-tetramethylcyclopenten-1-yl)silane.
| Compound Name | (3-tert-butyl-2-methoxy-5-methylphenyl)-dimethyl-(2,3,3,4-tetramethylcyclopenten-1-yl)silane |
|---|---|
| PubChem CID | 150340216 |
| Molecular Formula | C23H38OSi |
| Molecular Weight | 358.64 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | (3-tert-butyl-2-methoxy-5-methylphenyl)-dimethyl-(2,3,3,4-tetramethylcyclopenten-1-yl)silane |
| SMILES | COc1c(C(C)(C)C)cc(C)cc1[Si](C)(C)C1=C(C)C(C)(C)C(C)C1 |
| InChI | InChI=1S/C23H38OSi/c1-15-12-18(22(4,5)6)21(24-9)20(13-15)25(10,11)19-14-16(2)23(7,8)17(19)3/h12-13,16H,14H2,1-11H3 |
| InChIKey | GROAGLUEKVSWKB-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.64 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|