About chloro-(2,6-ditert-butyl-4-methylphenoxy)-dimethylsilane
chloro-(2,6-ditert-butyl-4-methylphenoxy)-dimethylsilane (PubChem CID 13254327) has the molecular formula C17H29ClOSi
and a molecular weight of 312.96 g/mol. Its IUPAC name is chloro-(2,6-ditert-butyl-4-methylphenoxy)-dimethylsilane.
Molecular Properties
| Compound Name | chloro-(2,6-ditert-butyl-4-methylphenoxy)-dimethylsilane |
| PubChem CID | 13254327 |
| Molecular Formula | C17H29ClOSi |
| Molecular Weight | 312.96 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | chloro-(2,6-ditert-butyl-4-methylphenoxy)-dimethylsilane |
| SMILES | Cc1cc(C(C)(C)C)c(O[Si](C)(C)Cl)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C17H29ClOSi/c1-12-10-13(16(2,3)4)15(19-20(8,9)18)14(11-12)17(5,6)7/h10-11H,1-9H3 |
| InChIKey | DDDJKVFRSZFKPM-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.96 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze chloro-(2,6-ditert-butyl-4-methylphenoxy)-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro-(2,6-ditert-butyl-4-methylphenoxy)-dimethylsilane?
The IUPAC name of chloro-(2,6-ditert-butyl-4-methylphenoxy)-dimethylsilane (CID 13254327) is chloro-(2,6-ditert-butyl-4-methylphenoxy)-dimethylsilane.
What is the SMILES notation for chloro-(2,6-ditert-butyl-4-methylphenoxy)-dimethylsilane?
The canonical SMILES for chloro-(2,6-ditert-butyl-4-methylphenoxy)-dimethylsilane is Cc1cc(C(C)(C)C)c(O[Si](C)(C)Cl)c(C(C)(C)C)c1.
What is the InChIKey of chloro-(2,6-ditert-butyl-4-methylphenoxy)-dimethylsilane?
The InChIKey is DDDJKVFRSZFKPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29ClOSi/c1-12-10-13(16(2,3)4)15(19-20(8,9)18)14(11-12)17(5,6)7/h10-11H,1-9H3.
What are the key properties of chloro-(2,6-ditert-butyl-4-methylphenoxy)-dimethylsilane?
chloro-(2,6-ditert-butyl-4-methylphenoxy)-dimethylsilane has a molecular weight of 312.96 g/mol, XLogP of 5.91, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chloro-(2,6-ditert-butyl-4-methylphenoxy)-dimethylsilane is sourced from PubChem (CID 13254327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).