About 2-tert-butyl-4,6-dimethylphenol
2-tert-butyl-4,6-dimethylphenol (PubChem CID 15884) has the molecular formula C12H18O
and a molecular weight of 178.27 g/mol. Its IUPAC name is 2-tert-butyl-4,6-dimethylphenol.
Molecular Properties
| Compound Name | 2-tert-butyl-4,6-dimethylphenol |
| PubChem CID | 15884 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 2-tert-butyl-4,6-dimethylphenol |
| SMILES | Cc1cc(C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C12H18O/c1-8-6-9(2)11(13)10(7-8)12(3,4)5/h6-7,13H,1-5H3 |
| InChIKey | OPLCSTZDXXUYDU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-tert-butyl-4,6-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-4,6-dimethylphenol?
The IUPAC name of 2-tert-butyl-4,6-dimethylphenol (CID 15884) is 2-tert-butyl-4,6-dimethylphenol.
What is the SMILES notation for 2-tert-butyl-4,6-dimethylphenol?
The canonical SMILES for 2-tert-butyl-4,6-dimethylphenol is Cc1cc(C)c(O)c(C(C)(C)C)c1.
What is the InChIKey of 2-tert-butyl-4,6-dimethylphenol?
The InChIKey is OPLCSTZDXXUYDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O/c1-8-6-9(2)11(13)10(7-8)12(3,4)5/h6-7,13H,1-5H3.
What are the key properties of 2-tert-butyl-4,6-dimethylphenol?
2-tert-butyl-4,6-dimethylphenol has a molecular weight of 178.27 g/mol, XLogP of 3.31, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-4,6-dimethylphenol is sourced from PubChem (CID 15884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).