C17H29O2P — CID 20731092
1,3-ditert-butyl-2-dimethylphosphoryloxy-5-methylbenzene (PubChem CID 20731092) has the molecular formula C17H29O2P and a molecular weight of 296.39 g/mol. Its IUPAC name is 1,3-ditert-butyl-2-dimethylphosphoryloxy-5-methylbenzene.
| Compound Name | 1,3-ditert-butyl-2-dimethylphosphoryloxy-5-methylbenzene |
|---|---|
| PubChem CID | 20731092 |
| Molecular Formula | C17H29O2P |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 1,3-ditert-butyl-2-dimethylphosphoryloxy-5-methylbenzene |
| SMILES | Cc1cc(C(C)(C)C)c(OP(C)(C)=O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C17H29O2P/c1-12-10-13(16(2,3)4)15(19-20(8,9)18)14(11-12)17(5,6)7/h10-11H,1-9H3 |
| InChIKey | QQOHFCOTYGWITB-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|