C30H46Na2O7P2 — CID 101137761
disodium;[(2,6-ditert-butyl-4-methylphenoxy)-oxidophosphoryl] (2,6-ditert-butyl-4-methylphenyl) phosphate (PubChem CID 101137761) has the molecular formula C30H46Na2O7P2 and a molecular weight of 626.62 g/mol. Its IUPAC name is disodium;[(2,6-ditert-butyl-4-methylphenoxy)-oxidophosphoryl] (2,6-ditert-butyl-4-methylphenyl) phosphate.
| Compound Name | disodium;[(2,6-ditert-butyl-4-methylphenoxy)-oxidophosphoryl] (2,6-ditert-butyl-4-methylphenyl) phosphate |
|---|---|
| PubChem CID | 101137761 |
| Molecular Formula | C30H46Na2O7P2 |
| Molecular Weight | 626.62 g/mol |
| Exact Mass | 626.25 |
| IUPAC Name | disodium;[(2,6-ditert-butyl-4-methylphenoxy)-oxidophosphoryl] (2,6-ditert-butyl-4-methylphenyl) phosphate |
| SMILES | Cc1cc(C(C)(C)C)c(OP(=O)([O-])OP(=O)([O-])Oc2c(C(C)(C)C)cc(C)cc2C(C)(C)C)c(C(C)(C)C)c1.[Na+].[Na+] |
| InChI | InChI=1S/C30H48O7P2.2Na/c1-19-15-21(27(3,4)5)25(22(16-19)28(6,7)8)35-38(31,32)37-39(33,34)36-26-23(29(9,10)11)17-20(2)18-24(26)30(12,13)14;;/h15-18H,1-14H3,(H,31,32)(H,33,34);;/q;2*+1/p-2 |
| InChIKey | RLQSNFSMEJWDPR-UHFFFAOYSA-L |
| XLogP | 1.91 |
| TPSA | 107.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.62 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|