C30H46CaO2 — CID 162348693
calcium bis(2,6-ditert-butyl-4-methylphenolate) (PubChem CID 162348693) has the molecular formula C30H46CaO2 and a molecular weight of 478.77 g/mol. Its IUPAC name is calcium bis(2,6-ditert-butyl-4-methylphenolate).
| Compound Name | calcium bis(2,6-ditert-butyl-4-methylphenolate) |
|---|---|
| PubChem CID | 162348693 |
| Molecular Formula | C30H46CaO2 |
| Molecular Weight | 478.77 g/mol |
| Exact Mass | 478.31 |
| IUPAC Name | calcium bis(2,6-ditert-butyl-4-methylphenolate) |
| SMILES | Cc1cc(C(C)(C)C)c([O-])c(C(C)(C)C)c1.Cc1cc(C(C)(C)C)c([O-])c(C(C)(C)C)c1.[Ca+2] |
| InChI | InChI=1S/2C15H24O.Ca/c2*1-10-8-11(14(2,3)4)13(16)12(9-10)15(5,6)7;/h2*8-9,16H,1-7H3;/q;;+2/p-2 |
| InChIKey | JIKYFAATKWVMCJ-UHFFFAOYSA-L |
| XLogP | 6.95 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.77 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |