C12H17LiO — CID 23711471
lithium 2-tert-butyl-4,6-dimethylphenolate (PubChem CID 23711471) has the molecular formula C12H17LiO and a molecular weight of 184.21 g/mol. Its IUPAC name is lithium 2-tert-butyl-4,6-dimethylphenolate.
| Compound Name | lithium 2-tert-butyl-4,6-dimethylphenolate |
|---|---|
| PubChem CID | 23711471 |
| Molecular Formula | C12H17LiO |
| Molecular Weight | 184.21 g/mol |
| Exact Mass | 184.14 |
| IUPAC Name | lithium 2-tert-butyl-4,6-dimethylphenolate |
| SMILES | Cc1cc(C)c([O-])c(C(C)(C)C)c1.[Li+] |
| InChI | InChI=1S/C12H18O.Li/c1-8-6-9(2)11(13)10(7-8)12(3,4)5;/h6-7,13H,1-5H3;/q;+1/p-1 |
| InChIKey | BTMSKTGJLWRGTK-UHFFFAOYSA-M |
| XLogP | -0.32 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.21 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |