C18H27BrO2 — CID 135079805
(2,6-ditert-butyl-4-methylphenyl) 2-bromopropanoate (PubChem CID 135079805) has the molecular formula C18H27BrO2 and a molecular weight of 355.32 g/mol. Its IUPAC name is (2,6-ditert-butyl-4-methylphenyl) 2-bromopropanoate.
| Compound Name | (2,6-ditert-butyl-4-methylphenyl) 2-bromopropanoate |
|---|---|
| PubChem CID | 135079805 |
| Molecular Formula | C18H27BrO2 |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | (2,6-ditert-butyl-4-methylphenyl) 2-bromopropanoate |
| SMILES | Cc1cc(C(C)(C)C)c(OC(=O)C(C)Br)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H27BrO2/c1-11-9-13(17(3,4)5)15(21-16(20)12(2)19)14(10-11)18(6,7)8/h9-10,12H,1-8H3 |
| InChIKey | AKENOIYWLNLBRN-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|