C18H30ClNO2 — CID 171192551
2,4-ditert-butyl-6-[(3R)-morpholin-3-yl]phenol;hydrochloride (PubChem CID 171192551) has the molecular formula C18H30ClNO2 and a molecular weight of 327.90 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[(3R)-morpholin-3-yl]phenol;hydrochloride.
| Compound Name | 2,4-ditert-butyl-6-[(3R)-morpholin-3-yl]phenol;hydrochloride |
|---|---|
| PubChem CID | 171192551 |
| Molecular Formula | C18H30ClNO2 |
| Molecular Weight | 327.90 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | 2,4-ditert-butyl-6-[(3R)-morpholin-3-yl]phenol;hydrochloride |
| SMILES | CC(C)(C)c1cc([C@@H]2COCCN2)c(O)c(C(C)(C)C)c1.Cl |
| InChI | InChI=1S/C18H29NO2.ClH/c1-17(2,3)12-9-13(15-11-21-8-7-19-15)16(20)14(10-12)18(4,5)6;/h9-10,15,19-20H,7-8,11H2,1-6H3;1H/t15-;/m0./s1 |
| InChIKey | XHTJAFFDZDPKFO-RSAXXLAASA-N |
| XLogP | 4.07 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.90 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|