C10H14ClNO4 — CID 171193502
2-[(3S)-morpholin-3-yl]benzene-1,3,5-triol;hydrochloride (PubChem CID 171193502) has the molecular formula C10H14ClNO4 and a molecular weight of 247.68 g/mol. Its IUPAC name is 2-[(3S)-morpholin-3-yl]benzene-1,3,5-triol;hydrochloride.
| Compound Name | 2-[(3S)-morpholin-3-yl]benzene-1,3,5-triol;hydrochloride |
|---|---|
| PubChem CID | 171193502 |
| Molecular Formula | C10H14ClNO4 |
| Molecular Weight | 247.68 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 2-[(3S)-morpholin-3-yl]benzene-1,3,5-triol;hydrochloride |
| SMILES | Cl.Oc1cc(O)c([C@H]2COCCN2)c(O)c1 |
| InChI | InChI=1S/C10H13NO4.ClH/c12-6-3-8(13)10(9(14)4-6)7-5-15-2-1-11-7;/h3-4,7,11-14H,1-2,5H2;1H/t7-;/m1./s1 |
| InChIKey | TZTVRTBGZXBLPY-OGFXRTJISA-N |
| XLogP | 0.89 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.68 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|