C12H16BrNO2 — CID 131417656
4-bromo-3,5-dimethyl-2-[(3R)-morpholin-3-yl]phenol (PubChem CID 131417656) has the molecular formula C12H16BrNO2 and a molecular weight of 286.17 g/mol. Its IUPAC name is 4-bromo-3,5-dimethyl-2-[(3R)-morpholin-3-yl]phenol.
| Compound Name | 4-bromo-3,5-dimethyl-2-[(3R)-morpholin-3-yl]phenol |
|---|---|
| PubChem CID | 131417656 |
| Molecular Formula | C12H16BrNO2 |
| Molecular Weight | 286.17 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 4-bromo-3,5-dimethyl-2-[(3R)-morpholin-3-yl]phenol |
| SMILES | Cc1cc(O)c([C@@H]2COCCN2)c(C)c1Br |
| InChI | InChI=1S/C12H16BrNO2/c1-7-5-10(15)11(8(2)12(7)13)9-6-16-4-3-14-9/h5,9,14-15H,3-4,6H2,1-2H3/t9-/m0/s1 |
| InChIKey | VWQDBQGVNBXGQZ-VIFPVBQESA-N |
| XLogP | 2.43 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.17 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|