C10H12Cl3NO — CID 171192450
(3R)-3-(2,6-dichlorophenyl)morpholine;hydrochloride (PubChem CID 171192450) has the molecular formula C10H12Cl3NO and a molecular weight of 268.57 g/mol. Its IUPAC name is (3R)-3-(2,6-dichlorophenyl)morpholine;hydrochloride.
| Compound Name | (3R)-3-(2,6-dichlorophenyl)morpholine;hydrochloride |
|---|---|
| PubChem CID | 171192450 |
| Molecular Formula | C10H12Cl3NO |
| Molecular Weight | 268.57 g/mol |
| Exact Mass | 267.00 |
| IUPAC Name | (3R)-3-(2,6-dichlorophenyl)morpholine;hydrochloride |
| SMILES | Cl.Clc1cccc(Cl)c1[C@@H]1COCCN1 |
| InChI | InChI=1S/C10H11Cl2NO.ClH/c11-7-2-1-3-8(12)10(7)9-6-14-5-4-13-9;/h1-3,9,13H,4-6H2;1H/t9-;/m0./s1 |
| InChIKey | YKQSISREBFRTKU-FVGYRXGTSA-N |
| XLogP | 3.08 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.57 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |