C10H11Cl3FNO — CID 171192935
(3R)-3-(2,3-dichloro-6-fluorophenyl)morpholine;hydrochloride (PubChem CID 171192935) has the molecular formula C10H11Cl3FNO and a molecular weight of 286.56 g/mol. Its IUPAC name is (3R)-3-(2,3-dichloro-6-fluorophenyl)morpholine;hydrochloride.
| Compound Name | (3R)-3-(2,3-dichloro-6-fluorophenyl)morpholine;hydrochloride |
|---|---|
| PubChem CID | 171192935 |
| Molecular Formula | C10H11Cl3FNO |
| Molecular Weight | 286.56 g/mol |
| Exact Mass | 284.99 |
| IUPAC Name | (3R)-3-(2,3-dichloro-6-fluorophenyl)morpholine;hydrochloride |
| SMILES | Cl.Fc1ccc(Cl)c(Cl)c1[C@@H]1COCCN1 |
| InChI | InChI=1S/C10H10Cl2FNO.ClH/c11-6-1-2-7(13)9(10(6)12)8-5-15-4-3-14-8;/h1-2,8,14H,3-5H2;1H/t8-;/m0./s1 |
| InChIKey | YUTVGVWJCPJSOJ-QRPNPIFTSA-N |
| XLogP | 3.22 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.56 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|