About (3S)-3-(3,6-difluoro-2-pyridinyl)morpholine
(3S)-3-(3,6-difluoro-2-pyridinyl)morpholine (PubChem CID 130648555) has the molecular formula C9H10F2N2O
and a molecular weight of 200.19 g/mol. Its IUPAC name is (3S)-3-(3,6-difluoro-2-pyridinyl)morpholine.
Molecular Properties
| Compound Name | (3S)-3-(3,6-difluoro-2-pyridinyl)morpholine |
| PubChem CID | 130648555 |
| Molecular Formula | C9H10F2N2O |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | (3S)-3-(3,6-difluoro-2-pyridinyl)morpholine |
| SMILES | Fc1ccc(F)c([C@H]2COCCN2)n1 |
| InChI | InChI=1S/C9H10F2N2O/c10-6-1-2-8(11)13-9(6)7-5-14-4-3-12-7/h1-2,7,12H,3-5H2/t7-/m1/s1 |
| InChIKey | BOESHWSCSFXHIM-SSDOTTSWSA-N |
| XLogP | 1.02 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-(3,6-difluoro-2-pyridinyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-(3,6-difluoro-2-pyridinyl)morpholine?
The IUPAC name of (3S)-3-(3,6-difluoro-2-pyridinyl)morpholine (CID 130648555) is (3S)-3-(3,6-difluoro-2-pyridinyl)morpholine.
What is the SMILES notation for (3S)-3-(3,6-difluoro-2-pyridinyl)morpholine?
The canonical SMILES for (3S)-3-(3,6-difluoro-2-pyridinyl)morpholine is Fc1ccc(F)c([C@H]2COCCN2)n1.
What is the InChIKey of (3S)-3-(3,6-difluoro-2-pyridinyl)morpholine?
The InChIKey is BOESHWSCSFXHIM-SSDOTTSWSA-N. The full InChI is InChI=1S/C9H10F2N2O/c10-6-1-2-8(11)13-9(6)7-5-14-4-3-12-7/h1-2,7,12H,3-5H2/t7-/m1/s1.
What are the key properties of (3S)-3-(3,6-difluoro-2-pyridinyl)morpholine?
(3S)-3-(3,6-difluoro-2-pyridinyl)morpholine has a molecular weight of 200.19 g/mol, XLogP of 1.02, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-(3,6-difluoro-2-pyridinyl)morpholine is sourced from PubChem (CID 130648555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).