C9H10Cl3N — CID 171196615
(2S)-2-(2,6-dichlorophenyl)azetidine;hydrochloride (PubChem CID 171196615) has the molecular formula C9H10Cl3N and a molecular weight of 238.54 g/mol. Its IUPAC name is (2S)-2-(2,6-dichlorophenyl)azetidine;hydrochloride.
| Compound Name | (2S)-2-(2,6-dichlorophenyl)azetidine;hydrochloride |
|---|---|
| PubChem CID | 171196615 |
| Molecular Formula | C9H10Cl3N |
| Molecular Weight | 238.54 g/mol |
| Exact Mass | 236.99 |
| IUPAC Name | (2S)-2-(2,6-dichlorophenyl)azetidine;hydrochloride |
| SMILES | Cl.Clc1cccc(Cl)c1[C@@H]1CCN1 |
| InChI | InChI=1S/C9H9Cl2N.ClH/c10-6-2-1-3-7(11)9(6)8-4-5-12-8;/h1-3,8,12H,4-5H2;1H/t8-;/m0./s1 |
| InChIKey | FPABDISYPPPKMC-QRPNPIFTSA-N |
| XLogP | 3.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.54 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |