C10H10Cl3N — CID 130622124
(2S)-2-(2,3,6-trichlorophenyl)pyrrolidine (PubChem CID 130622124) has the molecular formula C10H10Cl3N and a molecular weight of 250.56 g/mol. Its IUPAC name is (2S)-2-(2,3,6-trichlorophenyl)pyrrolidine.
| Compound Name | (2S)-2-(2,3,6-trichlorophenyl)pyrrolidine |
|---|---|
| PubChem CID | 130622124 |
| Molecular Formula | C10H10Cl3N |
| Molecular Weight | 250.56 g/mol |
| Exact Mass | 248.99 |
| IUPAC Name | (2S)-2-(2,3,6-trichlorophenyl)pyrrolidine |
| SMILES | Clc1ccc(Cl)c([C@@H]2CCCN2)c1Cl |
| InChI | InChI=1S/C10H10Cl3N/c11-6-3-4-7(12)10(13)9(6)8-2-1-5-14-8/h3-4,8,14H,1-2,5H2/t8-/m0/s1 |
| InChIKey | DMXOEFFHNCINRM-QMMMGPOBSA-N |
| XLogP | 4.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.56 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|