C10H11Cl3N2 — CID 171194626
(2R)-2-(2,3,6-trichlorophenyl)piperazine (PubChem CID 171194626) has the molecular formula C10H11Cl3N2 and a molecular weight of 265.57 g/mol. Its IUPAC name is (2R)-2-(2,3,6-trichlorophenyl)piperazine.
| Compound Name | (2R)-2-(2,3,6-trichlorophenyl)piperazine |
|---|---|
| PubChem CID | 171194626 |
| Molecular Formula | C10H11Cl3N2 |
| Molecular Weight | 265.57 g/mol |
| Exact Mass | 264.00 |
| IUPAC Name | (2R)-2-(2,3,6-trichlorophenyl)piperazine |
| SMILES | Clc1ccc(Cl)c([C@@H]2CNCCN2)c1Cl |
| InChI | InChI=1S/C10H11Cl3N2/c11-6-1-2-7(12)10(13)9(6)8-5-14-3-4-15-8/h1-2,8,14-15H,3-5H2/t8-/m0/s1 |
| InChIKey | OALTZMLYPCMCOI-QMMMGPOBSA-N |
| XLogP | 2.88 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.57 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|